![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
Internet Ray-Tracing Competition November 2006 -- December 2006 Directory ---------------------------------------------------------------------------- This directory holds all accepted submissions to the November-December-2006 Internet Ray-Tracing Competition, topic "Complexity"
| Name | Last modified | Size | |
|---|---|---|---|---|
| Parent Directory | - | ||
| zipped-up/ | 31-Jan-2007 07:02 | - | |
| 1004cplx.jpg | 25-Nov-2006 12:15 | 242K | |
| 1004cplx.txt | 25-Nov-2006 12:10 | 432 | |
| HIV.jpg | 06-Dec-2006 06:50 | 222K | |
| HIV.txt | 06-Dec-2006 06:49 | 1.5K | |
| NeuralNet.jpg | 30-Dec-2006 03:27 | 237K | |
| NeuralNet.txt | 30-Dec-2006 03:27 | 1.5K | |
| bowling.jpg | 26-Dec-2006 18:38 | 226K | |
| bowling.txt | 26-Dec-2006 18:39 | 1.7K | |
| cf_neuro.jpg | 26-Nov-2006 16:20 | 232K | |
| cf_neuro.txt | 26-Nov-2006 16:20 | 1.4K | |
| cf_neuro.zip | 26-Nov-2006 16:20 | 2.1K | |
| complex.jpg | 27-Dec-2006 20:03 | 231K | |
| complex.txt | 27-Dec-2006 20:03 | 1.2K | |
| cplxenuf.jpg | 25-Nov-2006 12:13 | 247K | |
| cplxenuf.txt | 25-Nov-2006 12:10 | 449 | |
| cplxrgnc.jpg | 25-Nov-2006 12:18 | 244K | |
| cplxrgnc.txt | 25-Nov-2006 12:10 | 433 | |
| dragon.jpg | 29-Dec-2006 20:13 | 124K | |
| dragon.pov.zip | 29-Dec-2006 20:15 | 1.6K | |
| dragon.txt | 29-Dec-2006 20:14 | 3.1K | |
| equilibrium.jpg | 29-Dec-2006 10:57 | 121K | |
| equilibrium.txt | 29-Dec-2006 10:57 | 601 | |
| grssland.jpg | 31-Dec-2006 05:03 | 241K | |
| grssland.txt | 31-Dec-2006 05:02 | 5.0K | |
| grssland.zip | 31-Dec-2006 05:04 | 2.3M | |
| matches.jpg | 31-Dec-2006 16:37 | 299K | |
| matches.txt | 31-Dec-2006 16:36 | 902 | |
| matches2.txt | 01-Jan-2007 21:55 | 2.5K | |
| mathexam.jpg | 31-Dec-2006 09:04 | 250K | |
| mathexam.txt | 31-Dec-2006 09:04 | 814 | |
| mathexam.zip | 31-Dec-2006 09:04 | 1.5M | |
| molecule.jpg | 18-Dec-2006 08:00 | 270K | |
| molecule.txt | 18-Dec-2006 08:00 | 1.6K | |
| ornmcplx.jpg | 25-Nov-2006 12:17 | 246K | |
| ornmcplx.txt | 25-Nov-2006 12:10 | 449 | |
| rb_shoot.jpg | 01-Jan-2007 09:00 | 248K | |
| rb_shoot.txt | 01-Jan-2007 09:00 | 1.3K | |
| rf_mcc.jpg | 31-Dec-2006 01:28 | 369K | |
| rf_mcc.txt | 31-Dec-2006 01:27 | 3.7K | |
| rf_mcc.zip | 31-Dec-2006 01:28 | 56K | |
| spirals.jpg | 31-Dec-2006 06:35 | 238K | |
| spirals.txt | 31-Dec-2006 06:35 | 2.4K | |
| train.jpg | 26-Dec-2006 13:23 | 251K | |
| train.txt | 26-Dec-2006 13:23 | 2.3K | |
| ts1203.jpg | 24-Dec-2006 22:02 | 221K | |
| ts1203.txt | 24-Dec-2006 22:02 | 879 | |
| twstcube.jpg | 31-Dec-2006 06:36 | 228K | |
| twstcube.txt | 31-Dec-2006 06:36 | 2.7K | |
| woman.jpg | 27-Dec-2006 08:24 | 120K | |
| woman.txt | 27-Dec-2006 08:24 | 905 | |